C25H27N5O4S2 — CID 135504001
methyl 4-[3-[2-[3-(dimethylsulfamoyl)phenyl]imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 135504001) has the molecular formula C25H27N5O4S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is methyl 4-[3-[2-[3-(dimethylsulfamoyl)phenyl]imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[3-[2-[3-(dimethylsulfamoyl)phenyl]imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 135504001 |
| Molecular Formula | C25H27N5O4S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | methyl 4-[3-[2-[3-(dimethylsulfamoyl)phenyl]imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C3=NN/C(=N/c4cccc(S(=O)(=O)N(C)C)c4)SC3)c2C)cc1 |
| InChI | InChI=1S/C25H27N5O4S2/c1-16-13-22(17(2)30(16)20-11-9-18(10-12-20)24(31)34-5)23-15-35-25(28-27-23)26-19-7-6-8-21(14-19)36(32,33)29(3)4/h6-14H,15H2,1-5H3,(H,26,28) |
| InChIKey | VJFFOJJBFNBMDI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|