C20H22N4O6S2 — CID 3293753
3-[[3-(4-methoxy-3-nitrobenzoyl)-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 3293753) has the molecular formula C20H22N4O6S2 and a molecular weight of 478.55 g/mol. Its IUPAC name is 3-[[3-(4-methoxy-3-nitrobenzoyl)-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[3-(4-methoxy-3-nitrobenzoyl)-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3293753 |
| Molecular Formula | C20H22N4O6S2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 3-[[3-(4-methoxy-3-nitrobenzoyl)-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(C(=O)N2CC(C)S/C2=N\c2cccc(S(=O)(=O)N(C)C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N4O6S2/c1-13-12-23(19(25)14-8-9-18(30-4)17(10-14)24(26)27)20(31-13)21-15-6-5-7-16(11-15)32(28,29)22(2)3/h5-11,13H,12H2,1-4H3/b21-20- |
| InChIKey | FXWWWEIXHSHKHY-MRCUWXFGSA-N |
| XLogP | 3.12 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|