C23H30N4O3S2 — CID 24555088
3-[[3-[3-[4-(dimethylamino)phenyl]propanoyl]-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 24555088) has the molecular formula C23H30N4O3S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 3-[[3-[3-[4-(dimethylamino)phenyl]propanoyl]-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[3-[3-[4-(dimethylamino)phenyl]propanoyl]-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24555088 |
| Molecular Formula | C23H30N4O3S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 3-[[3-[3-[4-(dimethylamino)phenyl]propanoyl]-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CC1CN(C(=O)CCc2ccc(N(C)C)cc2)/C(=N/c2cccc(S(=O)(=O)N(C)C)c2)S1 |
| InChI | InChI=1S/C23H30N4O3S2/c1-17-16-27(22(28)14-11-18-9-12-20(13-10-18)25(2)3)23(31-17)24-19-7-6-8-21(15-19)32(29,30)26(4)5/h6-10,12-13,15,17H,11,14,16H2,1-5H3/b24-23- |
| InChIKey | PRINFKKDTXDKOR-VHXPQNKSSA-N |
| XLogP | 3.59 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|