C23H29N3O4S2 — CID 4241065
N,N-dimethyl-3-[[5-methyl-3-[4-(3-methylphenoxy)butanoyl]-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide (PubChem CID 4241065) has the molecular formula C23H29N3O4S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is N,N-dimethyl-3-[[5-methyl-3-[4-(3-methylphenoxy)butanoyl]-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[[5-methyl-3-[4-(3-methylphenoxy)butanoyl]-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 4241065 |
| Molecular Formula | C23H29N3O4S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N,N-dimethyl-3-[[5-methyl-3-[4-(3-methylphenoxy)butanoyl]-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide |
| SMILES | Cc1cccc(OCCCC(=O)N2CC(C)S/C2=N\c2cccc(S(=O)(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C23H29N3O4S2/c1-17-8-5-10-20(14-17)30-13-7-12-22(27)26-16-18(2)31-23(26)24-19-9-6-11-21(15-19)32(28,29)25(3)4/h5-6,8-11,14-15,18H,7,12-13,16H2,1-4H3/b24-23- |
| InChIKey | HPWHFFUZEANKQI-VHXPQNKSSA-N |
| XLogP | 4.06 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|