C20H23N3O3S2 — CID 3478045
N,N-dimethyl-3-[[5-methyl-3-(2-phenylacetyl)-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide (PubChem CID 3478045) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is N,N-dimethyl-3-[[5-methyl-3-(2-phenylacetyl)-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[[5-methyl-3-(2-phenylacetyl)-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 3478045 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N,N-dimethyl-3-[[5-methyl-3-(2-phenylacetyl)-1,3-thiazolidin-2-ylidene]amino]benzenesulfonamide |
| SMILES | CC1CN(C(=O)Cc2ccccc2)/C(=N/c2cccc(S(=O)(=O)N(C)C)c2)S1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-15-14-23(19(24)12-16-8-5-4-6-9-16)20(27-15)21-17-10-7-11-18(13-17)28(25,26)22(2)3/h4-11,13,15H,12,14H2,1-3H3/b21-20- |
| InChIKey | TZBWXSVZBBBHPS-MRCUWXFGSA-N |
| XLogP | 3.13 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|