C14H21ClN2O4S — CID 119910755
(2S)-1-[[3-(dimethylsulfamoyl)phenyl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 119910755) has the molecular formula C14H21ClN2O4S and a molecular weight of 348.85 g/mol. Its IUPAC name is (2S)-1-[[3-(dimethylsulfamoyl)phenyl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2S)-1-[[3-(dimethylsulfamoyl)phenyl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119910755 |
| Molecular Formula | C14H21ClN2O4S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2S)-1-[[3-(dimethylsulfamoyl)phenyl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1cccc(CN2CCC[C@H]2C(=O)O)c1.Cl |
| InChI | InChI=1S/C14H20N2O4S.ClH/c1-15(2)21(19,20)12-6-3-5-11(9-12)10-16-8-4-7-13(16)14(17)18;/h3,5-6,9,13H,4,7-8,10H2,1-2H3,(H,17,18);1H/t13-;/m0./s1 |
| InChIKey | VYNDRYJUKHOFRP-ZOWNYOTGSA-N |
| XLogP | 1.41 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |