C19H21N3O3S2 — CID 7742194
3-[[(5R)-3-benzoyl-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 7742194) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-[[(5R)-3-benzoyl-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[(5R)-3-benzoyl-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 7742194 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 3-[[(5R)-3-benzoyl-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)/C(=N/c2cccc(S(=O)(=O)N(C)C)c2)S1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-14-13-22(18(23)15-8-5-4-6-9-15)19(26-14)20-16-10-7-11-17(12-16)27(24,25)21(2)3/h4-12,14H,13H2,1-3H3/b20-19-/t14-/m1/s1 |
| InChIKey | PGQUQUOTHZHMPG-BVGIJJTOSA-N |
| XLogP | 3.20 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|