C21H25N3O3S2 — CID 2574584
N,N-dimethyl-3-[2-(2-phenylethylimino)-1,3-thiazinane-3-carbonyl]benzenesulfonamide (PubChem CID 2574584) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-(2-phenylethylimino)-1,3-thiazinane-3-carbonyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[2-(2-phenylethylimino)-1,3-thiazinane-3-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2574584 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N,N-dimethyl-3-[2-(2-phenylethylimino)-1,3-thiazinane-3-carbonyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)N2CCCS/C2=N\CCc2ccccc2)c1 |
| InChI | InChI=1S/C21H25N3O3S2/c1-23(2)29(26,27)19-11-6-10-18(16-19)20(25)24-14-7-15-28-21(24)22-13-12-17-8-4-3-5-9-17/h3-6,8-11,16H,7,12-15H2,1-2H3/b22-21- |
| InChIKey | ORZPWWYTKIYHNS-DQRAZIAOSA-N |
| XLogP | 3.11 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|