C19H20FN3O3S2 — CID 3989778
3-[[3-(2-fluorobenzoyl)-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 3989778) has the molecular formula C19H20FN3O3S2 and a molecular weight of 421.52 g/mol. Its IUPAC name is 3-[[3-(2-fluorobenzoyl)-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[3-(2-fluorobenzoyl)-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3989778 |
| Molecular Formula | C19H20FN3O3S2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 3-[[3-(2-fluorobenzoyl)-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CC1CN(C(=O)c2ccccc2F)/C(=N/c2cccc(S(=O)(=O)N(C)C)c2)S1 |
| InChI | InChI=1S/C19H20FN3O3S2/c1-13-12-23(18(24)16-9-4-5-10-17(16)20)19(27-13)21-14-7-6-8-15(11-14)28(25,26)22(2)3/h4-11,13H,12H2,1-3H3/b21-19- |
| InChIKey | XSPOUZQHAFORCY-VZCXRCSSSA-N |
| XLogP | 3.34 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|