C17H14ClFN2OS — CID 832823
[(5R)-2-(2-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-(2-fluorophenyl)methanone (PubChem CID 832823) has the molecular formula C17H14ClFN2OS and a molecular weight of 348.83 g/mol. Its IUPAC name is [(5R)-2-(2-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(5R)-2-(2-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 832823 |
| Molecular Formula | C17H14ClFN2OS |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | [(5R)-2-(2-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-(2-fluorophenyl)methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2F)/C(=N/c2ccccc2Cl)S1 |
| InChI | InChI=1S/C17H14ClFN2OS/c1-11-10-21(16(22)12-6-2-4-8-14(12)19)17(23-11)20-15-9-5-3-7-13(15)18/h2-9,11H,10H2,1H3/b20-17-/t11-/m1/s1 |
| InChIKey | ZNBKDZHODAQBRP-PLYKVXEXSA-N |
| XLogP | 4.74 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|