C18H15Cl2FN2OS — CID 7916524
2-(2-chloro-6-fluorophenyl)-1-[(5S)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]ethanone (PubChem CID 7916524) has the molecular formula C18H15Cl2FN2OS and a molecular weight of 397.30 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[(5S)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[(5S)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 7916524 |
| Molecular Formula | C18H15Cl2FN2OS |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[(5S)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]ethanone |
| SMILES | C[C@H]1CN(C(=O)Cc2c(F)cccc2Cl)/C(=N/c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C18H15Cl2FN2OS/c1-11-10-23(17(24)9-14-15(20)3-2-4-16(14)21)18(25-11)22-13-7-5-12(19)6-8-13/h2-8,11H,9-10H2,1H3/b22-18-/t11-/m0/s1 |
| InChIKey | CUESNYHAODRVEC-UDJRCTOUSA-N |
| XLogP | 5.33 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|