C18H14ClN3OS — CID 7916517
4-[(5S)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidine-3-carbonyl]benzonitrile (PubChem CID 7916517) has the molecular formula C18H14ClN3OS and a molecular weight of 355.85 g/mol. Its IUPAC name is 4-[(5S)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidine-3-carbonyl]benzonitrile.
| Compound Name | 4-[(5S)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidine-3-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 7916517 |
| Molecular Formula | C18H14ClN3OS |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 4-[(5S)-2-(4-chlorophenyl)imino-5-methyl-1,3-thiazolidine-3-carbonyl]benzonitrile |
| SMILES | C[C@H]1CN(C(=O)c2ccc(C#N)cc2)/C(=N/c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C18H14ClN3OS/c1-12-11-22(17(23)14-4-2-13(10-20)3-5-14)18(24-12)21-16-8-6-15(19)7-9-16/h2-9,12H,11H2,1H3/b21-18-/t12-/m0/s1 |
| InChIKey | LQBHXOAIOOCJCS-LCDJAWGCSA-N |
| XLogP | 4.48 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|