C20H19N3OS — CID 8800345
4-[2-(2,6-dimethylphenyl)imino-1,3-thiazinane-3-carbonyl]benzonitrile (PubChem CID 8800345) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-[2-(2,6-dimethylphenyl)imino-1,3-thiazinane-3-carbonyl]benzonitrile.
| Compound Name | 4-[2-(2,6-dimethylphenyl)imino-1,3-thiazinane-3-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 8800345 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[2-(2,6-dimethylphenyl)imino-1,3-thiazinane-3-carbonyl]benzonitrile |
| SMILES | Cc1cccc(C)c1/N=C1\SCCCN1C(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H19N3OS/c1-14-5-3-6-15(2)18(14)22-20-23(11-4-12-25-20)19(24)17-9-7-16(13-21)8-10-17/h3,5-10H,4,11-12H2,1-2H3/b22-20- |
| InChIKey | GDPKFGJHZVVFHU-XDOYNYLZSA-N |
| XLogP | 4.44 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|