C23H22N2OS — CID 7943468
[2-(2,5-dimethylphenyl)imino-1,3-thiazinan-3-yl]-naphthalen-2-ylmethanone (PubChem CID 7943468) has the molecular formula C23H22N2OS and a molecular weight of 374.51 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)imino-1,3-thiazinan-3-yl]-naphthalen-2-ylmethanone.
| Compound Name | [2-(2,5-dimethylphenyl)imino-1,3-thiazinan-3-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 7943468 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [2-(2,5-dimethylphenyl)imino-1,3-thiazinan-3-yl]-naphthalen-2-ylmethanone |
| SMILES | Cc1ccc(C)c(/N=C2\SCCCN2C(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C23H22N2OS/c1-16-8-9-17(2)21(14-16)24-23-25(12-5-13-27-23)22(26)20-11-10-18-6-3-4-7-19(18)15-20/h3-4,6-11,14-15H,5,12-13H2,1-2H3/b24-23- |
| InChIKey | LSBFWADHXIUMOM-VHXPQNKSSA-N |
| XLogP | 5.72 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|