C20H18ClN3O2S2 — CID 40855992
(2R)-6-[2-(2-chlorophenyl)imino-1,3-thiazinane-3-carbonyl]-2-methyl-4H-1,4-benzothiazin-3-one (PubChem CID 40855992) has the molecular formula C20H18ClN3O2S2 and a molecular weight of 431.97 g/mol. Its IUPAC name is (2R)-6-[2-(2-chlorophenyl)imino-1,3-thiazinane-3-carbonyl]-2-methyl-4H-1,4-benzothiazin-3-one.
| Compound Name | (2R)-6-[2-(2-chlorophenyl)imino-1,3-thiazinane-3-carbonyl]-2-methyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 40855992 |
| Molecular Formula | C20H18ClN3O2S2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | (2R)-6-[2-(2-chlorophenyl)imino-1,3-thiazinane-3-carbonyl]-2-methyl-4H-1,4-benzothiazin-3-one |
| SMILES | C[C@H]1Sc2ccc(C(=O)N3CCCS/C3=N\c3ccccc3Cl)cc2NC1=O |
| InChI | InChI=1S/C20H18ClN3O2S2/c1-12-18(25)22-16-11-13(7-8-17(16)28-12)19(26)24-9-4-10-27-20(24)23-15-6-3-2-5-14(15)21/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,22,25)/b23-20-/t12-/m1/s1 |
| InChIKey | UZPXJLAXWIVHQM-GCDPVWBDSA-N |
| XLogP | 5.04 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|