C21H23N3O2S2 — CID 162521097
2-methyl-3-oxo-N-(3-piperidin-1-ylsulfanylphenyl)-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 162521097) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-(3-piperidin-1-ylsulfanylphenyl)-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | 2-methyl-3-oxo-N-(3-piperidin-1-ylsulfanylphenyl)-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 162521097 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-methyl-3-oxo-N-(3-piperidin-1-ylsulfanylphenyl)-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CC1Sc2ccc(C(=O)Nc3cccc(SN4CCCCC4)c3)cc2NC1=O |
| InChI | InChI=1S/C21H23N3O2S2/c1-14-20(25)23-18-12-15(8-9-19(18)27-14)21(26)22-16-6-5-7-17(13-16)28-24-10-3-2-4-11-24/h5-9,12-14H,2-4,10-11H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | DOGYBYKGTVVGKO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|