C27H28N4O4S2 — CID 166899427
tert-butyl N-[4-[[3-[(2-methyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl)amino]phenyl]sulfanylamino]phenyl]carbamate (PubChem CID 166899427) has the molecular formula C27H28N4O4S2 and a molecular weight of 536.68 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-[(2-methyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl)amino]phenyl]sulfanylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-[(2-methyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl)amino]phenyl]sulfanylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 166899427 |
| Molecular Formula | C27H28N4O4S2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | tert-butyl N-[4-[[3-[(2-methyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl)amino]phenyl]sulfanylamino]phenyl]carbamate |
| SMILES | CC1Sc2ccc(C(=O)Nc3cccc(SNc4ccc(NC(=O)OC(C)(C)C)cc4)c3)cc2NC1=O |
| InChI | InChI=1S/C27H28N4O4S2/c1-16-24(32)30-22-14-17(8-13-23(22)36-16)25(33)28-20-6-5-7-21(15-20)37-31-19-11-9-18(10-12-19)29-26(34)35-27(2,3)4/h5-16,31H,1-4H3,(H,28,33)(H,29,34)(H,30,32) |
| InChIKey | ICZLCFJWDFUKMT-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|