C22H21N4O4S2+ — CID 162521272
CID 162521272 (PubChem CID 162521272) has the molecular formula C22H21N4O4S2+ and a molecular weight of 469.57 g/mol.
| Compound Name | CID 162521272 |
|---|---|
| PubChem CID | 162521272 |
| Molecular Formula | C22H21N4O4S2+ |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | — |
| SMILES | CC1Sc2ccc(C(=O)Nc3cccc([S+](=O)(O)Nc4ccc(N)cc4)c3)cc2NC1=O |
| InChI | InChI=1S/C22H20N4O4S2/c1-13-21(27)25-19-11-14(5-10-20(19)31-13)22(28)24-17-3-2-4-18(12-17)32(29,30)26-16-8-6-15(23)7-9-16/h2-13H,23H2,1H3,(H3-,24,25,26,27,28,29,30)/p+1 |
| InChIKey | HCVOYEGLMMQMHE-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|