C16H19ClN2OS — CID 7921363
[2-(2-chlorophenyl)imino-1,3-thiazinan-3-yl]-cyclopentylmethanone (PubChem CID 7921363) has the molecular formula C16H19ClN2OS and a molecular weight of 322.86 g/mol. Its IUPAC name is [2-(2-chlorophenyl)imino-1,3-thiazinan-3-yl]-cyclopentylmethanone.
| Compound Name | [2-(2-chlorophenyl)imino-1,3-thiazinan-3-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 7921363 |
| Molecular Formula | C16H19ClN2OS |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [2-(2-chlorophenyl)imino-1,3-thiazinan-3-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCCS/C1=N\c1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN2OS/c17-13-8-3-4-9-14(13)18-16-19(10-5-11-21-16)15(20)12-6-1-2-7-12/h3-4,8-9,12H,1-2,5-7,10-11H2/b18-16- |
| InChIKey | CLJIHGFTZNAZNI-VLGSPTGOSA-N |
| XLogP | 4.48 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|