C17H14Cl3N3OS — CID 3094981
2-(2-chlorophenyl)imino-N-(3,4-dichlorophenyl)-5-methyl-1,3-thiazolidine-3-carboxamide (PubChem CID 3094981) has the molecular formula C17H14Cl3N3OS and a molecular weight of 414.75 g/mol. Its IUPAC name is 2-(2-chlorophenyl)imino-N-(3,4-dichlorophenyl)-5-methyl-1,3-thiazolidine-3-carboxamide.
| Compound Name | 2-(2-chlorophenyl)imino-N-(3,4-dichlorophenyl)-5-methyl-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 3094981 |
| Molecular Formula | C17H14Cl3N3OS |
| Molecular Weight | 414.75 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | 2-(2-chlorophenyl)imino-N-(3,4-dichlorophenyl)-5-methyl-1,3-thiazolidine-3-carboxamide |
| SMILES | CC1CN(C(=O)Nc2ccc(Cl)c(Cl)c2)/C(=N/c2ccccc2Cl)S1 |
| InChI | InChI=1S/C17H14Cl3N3OS/c1-10-9-23(16(24)21-11-6-7-12(18)14(20)8-11)17(25-10)22-15-5-3-2-4-13(15)19/h2-8,10H,9H2,1H3,(H,21,24)/b22-17- |
| InChIKey | UWLASOSIFLFLDH-XLNRJJMWSA-N |
| XLogP | 6.30 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|