C19H20Cl2N4OS — CID 1119068
(5R)-N-(3,4-dichlorophenyl)-2-[4-(dimethylamino)phenyl]imino-5-methyl-1,3-thiazolidine-3-carboxamide (PubChem CID 1119068) has the molecular formula C19H20Cl2N4OS and a molecular weight of 423.37 g/mol. Its IUPAC name is (5R)-N-(3,4-dichlorophenyl)-2-[4-(dimethylamino)phenyl]imino-5-methyl-1,3-thiazolidine-3-carboxamide.
| Compound Name | (5R)-N-(3,4-dichlorophenyl)-2-[4-(dimethylamino)phenyl]imino-5-methyl-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 1119068 |
| Molecular Formula | C19H20Cl2N4OS |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | (5R)-N-(3,4-dichlorophenyl)-2-[4-(dimethylamino)phenyl]imino-5-methyl-1,3-thiazolidine-3-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)Nc2ccc(Cl)c(Cl)c2)/C(=N/c2ccc(N(C)C)cc2)S1 |
| InChI | InChI=1S/C19H20Cl2N4OS/c1-12-11-25(18(26)22-14-6-9-16(20)17(21)10-14)19(27-12)23-13-4-7-15(8-5-13)24(2)3/h4-10,12H,11H2,1-3H3,(H,22,26)/b23-19-/t12-/m1/s1 |
| InChIKey | NPFSSFGNXNPELV-JLEISICNSA-N |
| XLogP | 5.72 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|