C20H22ClN3S2 — CID 12784223
N-(3-chlorophenyl)-5-methyl-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidine-3-carbothioamide (PubChem CID 12784223) has the molecular formula C20H22ClN3S2 and a molecular weight of 404.00 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-methyl-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-5-methyl-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 12784223 |
| Molecular Formula | C20H22ClN3S2 |
| Molecular Weight | 404.00 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-(3-chlorophenyl)-5-methyl-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidine-3-carbothioamide |
| SMILES | CC1CN(C(=S)Nc2cccc(Cl)c2)/C(=N/c2ccc(C(C)C)cc2)S1 |
| InChI | InChI=1S/C20H22ClN3S2/c1-13(2)15-7-9-17(10-8-15)23-20-24(12-14(3)26-20)19(25)22-18-6-4-5-16(21)11-18/h4-11,13-14H,12H2,1-3H3,(H,22,25)/b23-20- |
| InChIKey | ZUVGTSGGZGRILD-ATJXCDBQSA-N |
| XLogP | 6.29 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.00 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|