C18H24ClN3S2 — CID 12784215
N-(3-chlorophenyl)-2-cycloheptylimino-5-methyl-1,3-thiazolidine-3-carbothioamide (PubChem CID 12784215) has the molecular formula C18H24ClN3S2 and a molecular weight of 382.00 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-cycloheptylimino-5-methyl-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-2-cycloheptylimino-5-methyl-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 12784215 |
| Molecular Formula | C18H24ClN3S2 |
| Molecular Weight | 382.00 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-(3-chlorophenyl)-2-cycloheptylimino-5-methyl-1,3-thiazolidine-3-carbothioamide |
| SMILES | CC1CN(C(=S)Nc2cccc(Cl)c2)/C(=N/C2CCCCCC2)S1 |
| InChI | InChI=1S/C18H24ClN3S2/c1-13-12-22(17(23)20-16-10-6-7-14(19)11-16)18(24-13)21-15-8-4-2-3-5-9-15/h6-7,10-11,13,15H,2-5,8-9,12H2,1H3,(H,20,23)/b21-18- |
| InChIKey | CKHKEMMKFKFYIM-UZYVYHOESA-N |
| XLogP | 5.55 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.00 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|