C22H28ClN3S2 — CID 88765557
N-(3-chlorophenyl)-2-[(1E,7E)-cyclododeca-1,7-dien-1-yl]imino-1,3-thiazolidine-3-carbothioamide (PubChem CID 88765557) has the molecular formula C22H28ClN3S2 and a molecular weight of 434.07 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(1E,7E)-cyclododeca-1,7-dien-1-yl]imino-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-(3-chlorophenyl)-2-[(1E,7E)-cyclododeca-1,7-dien-1-yl]imino-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 88765557 |
| Molecular Formula | C22H28ClN3S2 |
| Molecular Weight | 434.07 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(1E,7E)-cyclododeca-1,7-dien-1-yl]imino-1,3-thiazolidine-3-carbothioamide |
| SMILES | S=C(Nc1cccc(Cl)c1)N1CCS/C1=N\C1=C\CCCC/C=C/CCCC1 |
| InChI | InChI=1S/C22H28ClN3S2/c23-18-11-10-14-20(17-18)24-21(27)26-15-16-28-22(26)25-19-12-8-6-4-2-1-3-5-7-9-13-19/h1-2,10-11,13-14,17H,3-9,12,15-16H2,(H,24,27)/b2-1+,19-13+,25-22- |
| InChIKey | LWJSGLFTBZESSJ-QKTNZALVSA-N |
| XLogP | 7.02 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.07 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|