C18H15F4N3OS2 — CID 12784266
2-phenylimino-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide (PubChem CID 12784266) has the molecular formula C18H15F4N3OS2 and a molecular weight of 429.46 g/mol. Its IUPAC name is 2-phenylimino-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide.
| Compound Name | 2-phenylimino-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 12784266 |
| Molecular Formula | C18H15F4N3OS2 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-phenylimino-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide |
| SMILES | FC(F)C(F)(F)Oc1cccc(NC(=S)N2CCS/C2=N\c2ccccc2)c1 |
| InChI | InChI=1S/C18H15F4N3OS2/c19-15(20)18(21,22)26-14-8-4-7-13(11-14)23-16(27)25-9-10-28-17(25)24-12-5-2-1-3-6-12/h1-8,11,15H,9-10H2,(H,23,27)/b24-17- |
| InChIKey | PARNWBVFQWNEPH-ULJHMMPZSA-N |
| XLogP | 5.36 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|