C26H22ClF4N3S2 — CID 25168804
2-[1-(2-chloro-3-methylphenyl)-2-(3-fluorophenyl)ethyl]imino-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carbothioamide (PubChem CID 25168804) has the molecular formula C26H22ClF4N3S2 and a molecular weight of 552.06 g/mol. Its IUPAC name is 2-[1-(2-chloro-3-methylphenyl)-2-(3-fluorophenyl)ethyl]imino-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carbothioamide.
| Compound Name | 2-[1-(2-chloro-3-methylphenyl)-2-(3-fluorophenyl)ethyl]imino-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 25168804 |
| Molecular Formula | C26H22ClF4N3S2 |
| Molecular Weight | 552.06 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | 2-[1-(2-chloro-3-methylphenyl)-2-(3-fluorophenyl)ethyl]imino-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carbothioamide |
| SMILES | Cc1cccc(C(Cc2cccc(F)c2)/N=C2\SCCN2C(=S)Nc2cccc(C(F)(F)F)c2)c1Cl |
| InChI | InChI=1S/C26H22ClF4N3S2/c1-16-5-2-10-21(23(16)27)22(14-17-6-3-8-19(28)13-17)33-25-34(11-12-36-25)24(35)32-20-9-4-7-18(15-20)26(29,30)31/h2-10,13,15,22H,11-12,14H2,1H3,(H,32,35)/b33-25- |
| InChIKey | OEYFVWAOEOVHKC-IVQJCJPDSA-N |
| XLogP | 7.89 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.06 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|