C20H17N3S2 — CID 3297227
N-naphthalen-1-yl-2-phenylimino-1,3-thiazolidine-3-carbothioamide (PubChem CID 3297227) has the molecular formula C20H17N3S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-phenylimino-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-naphthalen-1-yl-2-phenylimino-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 3297227 |
| Molecular Formula | C20H17N3S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-naphthalen-1-yl-2-phenylimino-1,3-thiazolidine-3-carbothioamide |
| SMILES | S=C(Nc1cccc2ccccc12)N1CCS/C1=N\c1ccccc1 |
| InChI | InChI=1S/C20H17N3S2/c24-19(22-18-12-6-8-15-7-4-5-11-17(15)18)23-13-14-25-20(23)21-16-9-2-1-3-10-16/h1-12H,13-14H2,(H,22,24)/b21-20- |
| InChIKey | CBQRMLGSEBONRZ-MRCUWXFGSA-N |
| XLogP | 5.27 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|