C18H16Cl2N2OS — CID 7948452
2-(2,6-dichlorophenyl)-1-(2-phenylimino-1,3-thiazinan-3-yl)ethanone (PubChem CID 7948452) has the molecular formula C18H16Cl2N2OS and a molecular weight of 379.31 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(2-phenylimino-1,3-thiazinan-3-yl)ethanone.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(2-phenylimino-1,3-thiazinan-3-yl)ethanone |
|---|---|
| PubChem CID | 7948452 |
| Molecular Formula | C18H16Cl2N2OS |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(2-phenylimino-1,3-thiazinan-3-yl)ethanone |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)N1CCCS/C1=N\c1ccccc1 |
| InChI | InChI=1S/C18H16Cl2N2OS/c19-15-8-4-9-16(20)14(15)12-17(23)22-10-5-11-24-18(22)21-13-6-2-1-3-7-13/h1-4,6-9H,5,10-12H2/b21-18- |
| InChIKey | BBVLTMPOESGIHA-UZYVYHOESA-N |
| XLogP | 5.19 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|