C20H21ClN2O2S — CID 18286293
1-[2-(2-chlorophenyl)imino-1,3-thiazinan-3-yl]-2-(2,5-dimethylphenoxy)ethanone (PubChem CID 18286293) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)imino-1,3-thiazinan-3-yl]-2-(2,5-dimethylphenoxy)ethanone.
| Compound Name | 1-[2-(2-chlorophenyl)imino-1,3-thiazinan-3-yl]-2-(2,5-dimethylphenoxy)ethanone |
|---|---|
| PubChem CID | 18286293 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-[2-(2-chlorophenyl)imino-1,3-thiazinan-3-yl]-2-(2,5-dimethylphenoxy)ethanone |
| SMILES | Cc1ccc(C)c(OCC(=O)N2CCCS/C2=N\c2ccccc2Cl)c1 |
| InChI | InChI=1S/C20H21ClN2O2S/c1-14-8-9-15(2)18(12-14)25-13-19(24)23-10-5-11-26-20(23)22-17-7-4-3-6-16(17)21/h3-4,6-9,12H,5,10-11,13H2,1-2H3/b22-20- |
| InChIKey | RWQQEJPJMIBMLD-XDOYNYLZSA-N |
| XLogP | 4.99 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|