C17H15FN2OS — CID 832819
(2-fluorophenyl)-(2-phenylimino-1,3-thiazinan-3-yl)methanone (PubChem CID 832819) has the molecular formula C17H15FN2OS and a molecular weight of 314.38 g/mol. Its IUPAC name is (2-fluorophenyl)-(2-phenylimino-1,3-thiazinan-3-yl)methanone.
| Compound Name | (2-fluorophenyl)-(2-phenylimino-1,3-thiazinan-3-yl)methanone |
|---|---|
| PubChem CID | 832819 |
| Molecular Formula | C17H15FN2OS |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (2-fluorophenyl)-(2-phenylimino-1,3-thiazinan-3-yl)methanone |
| SMILES | O=C(c1ccccc1F)N1CCCS/C1=N\c1ccccc1 |
| InChI | InChI=1S/C17H15FN2OS/c18-15-10-5-4-9-14(15)16(21)20-11-6-12-22-17(20)19-13-7-2-1-3-8-13/h1-5,7-10H,6,11-12H2/b19-17- |
| InChIKey | OKLCJWQBOSEACI-ZPHPHTNESA-N |
| XLogP | 4.09 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|