C17H16N2O2S — CID 3383732
3-(furan-2-yl)-1-(2-phenylimino-1,3-thiazinan-3-yl)prop-2-en-1-one (PubChem CID 3383732) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-(2-phenylimino-1,3-thiazinan-3-yl)prop-2-en-1-one.
| Compound Name | 3-(furan-2-yl)-1-(2-phenylimino-1,3-thiazinan-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3383732 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 3-(furan-2-yl)-1-(2-phenylimino-1,3-thiazinan-3-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccco1)N1CCCS/C1=N\c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2S/c20-16(10-9-15-8-4-12-21-15)19-11-5-13-22-17(19)18-14-6-2-1-3-7-14/h1-4,6-10,12H,5,11,13H2/b10-9?,18-17- |
| InChIKey | CBNODNLGNZZZQN-GPAUUMAZSA-N |
| XLogP | 3.95 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|