C18H18N2O2S — CID 4966503
3-(furan-2-yl)-1-[2-(1-phenylethylimino)-1,3-thiazolidin-3-yl]prop-2-en-1-one (PubChem CID 4966503) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-[2-(1-phenylethylimino)-1,3-thiazolidin-3-yl]prop-2-en-1-one.
| Compound Name | 3-(furan-2-yl)-1-[2-(1-phenylethylimino)-1,3-thiazolidin-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4966503 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-(furan-2-yl)-1-[2-(1-phenylethylimino)-1,3-thiazolidin-3-yl]prop-2-en-1-one |
| SMILES | CC(/N=C1\SCCN1C(=O)C=Cc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2S/c1-14(15-6-3-2-4-7-15)19-18-20(11-13-23-18)17(21)10-9-16-8-5-12-22-16/h2-10,12,14H,11,13H2,1H3/b10-9?,19-18- |
| InChIKey | YOZTVWZOSVIIAM-FQSGZOLCSA-N |
| XLogP | 3.99 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|