C10H9NO4 — CID 139256760
3-[(E)-3-(furan-2-yl)prop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 139256760) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139256760 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/c1ccco1)N1CCOC1=O |
| InChI | InChI=1S/C10H9NO4/c12-9(11-5-7-15-10(11)13)4-3-8-2-1-6-14-8/h1-4,6H,5,7H2/b4-3+ |
| InChIKey | FBOQGYOHCIDOEW-ONEGZZNKSA-N |
| XLogP | 1.27 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|