C12H12N2O3 — CID 70017633
(1S,5R)-2-[3-(furan-2-yl)prop-2-enoyl]-2,6-diazabicyclo[3.2.0]heptan-7-one (PubChem CID 70017633) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is (1S,5R)-2-[3-(furan-2-yl)prop-2-enoyl]-2,6-diazabicyclo[3.2.0]heptan-7-one.
| Compound Name | (1S,5R)-2-[3-(furan-2-yl)prop-2-enoyl]-2,6-diazabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 70017633 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (1S,5R)-2-[3-(furan-2-yl)prop-2-enoyl]-2,6-diazabicyclo[3.2.0]heptan-7-one |
| SMILES | O=C1N[C@@H]2CCN(C(=O)C=Cc3ccco3)[C@H]12 |
| InChI | InChI=1S/C12H12N2O3/c15-10(4-3-8-2-1-7-17-8)14-6-5-9-11(14)12(16)13-9/h1-4,7,9,11H,5-6H2,(H,13,16)/t9-,11+/m1/s1 |
| InChIKey | AKDWPEHFPRIGDJ-KOLCDFICSA-N |
| XLogP | 0.39 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|