C12H11NO4 — CID 95985273
(1S,4S)-5-[(E)-3-(furan-2-yl)prop-2-enoyl]-2-oxa-5-azabicyclo[2.2.1]heptan-3-one (PubChem CID 95985273) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is (1S,4S)-5-[(E)-3-(furan-2-yl)prop-2-enoyl]-2-oxa-5-azabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1S,4S)-5-[(E)-3-(furan-2-yl)prop-2-enoyl]-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 95985273 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (1S,4S)-5-[(E)-3-(furan-2-yl)prop-2-enoyl]-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
| SMILES | O=C1O[C@H]2C[C@@H]1N(C(=O)/C=C/c1ccco1)C2 |
| InChI | InChI=1S/C12H11NO4/c14-11(4-3-8-2-1-5-16-8)13-7-9-6-10(13)12(15)17-9/h1-5,9-10H,6-7H2/b4-3+/t9-,10-/m0/s1 |
| InChIKey | XQJRQRRXWLXLLE-OHINUGQQSA-N |
| XLogP | 0.82 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|