C16H14FNO2 — CID 76857507
1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 76857507) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is 1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | 1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 76857507 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccco1)N1CCCc2cccc(F)c21 |
| InChI | InChI=1S/C16H14FNO2/c17-14-7-1-4-12-5-2-10-18(16(12)14)15(19)9-8-13-6-3-11-20-13/h1,3-4,6-9,11H,2,5,10H2 |
| InChIKey | MGYAFDKYUIUAQF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|