C18H17FN2OS — CID 7947794
(2-fluorophenyl)-[2-(2-methylphenyl)imino-1,3-thiazinan-3-yl]methanone (PubChem CID 7947794) has the molecular formula C18H17FN2OS and a molecular weight of 328.41 g/mol. Its IUPAC name is (2-fluorophenyl)-[2-(2-methylphenyl)imino-1,3-thiazinan-3-yl]methanone.
| Compound Name | (2-fluorophenyl)-[2-(2-methylphenyl)imino-1,3-thiazinan-3-yl]methanone |
|---|---|
| PubChem CID | 7947794 |
| Molecular Formula | C18H17FN2OS |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (2-fluorophenyl)-[2-(2-methylphenyl)imino-1,3-thiazinan-3-yl]methanone |
| SMILES | Cc1ccccc1/N=C1\SCCCN1C(=O)c1ccccc1F |
| InChI | InChI=1S/C18H17FN2OS/c1-13-7-2-5-10-16(13)20-18-21(11-6-12-23-18)17(22)14-8-3-4-9-15(14)19/h2-5,7-10H,6,11-12H2,1H3/b20-18- |
| InChIKey | OQGJXLVMRLGSSV-ZZEZOPTASA-N |
| XLogP | 4.40 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|