C22H24N4O4S — CID 18284435
[2-(2-methylphenyl)imino-1,3-thiazinan-3-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone (PubChem CID 18284435) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is [2-(2-methylphenyl)imino-1,3-thiazinan-3-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone.
| Compound Name | [2-(2-methylphenyl)imino-1,3-thiazinan-3-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 18284435 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | [2-(2-methylphenyl)imino-1,3-thiazinan-3-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
| SMILES | Cc1ccccc1/N=C1\SCCCN1C(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N4O4S/c1-16-5-2-3-6-18(16)23-22-25(9-4-14-31-22)21(27)17-7-8-19(20(15-17)26(28)29)24-10-12-30-13-11-24/h2-3,5-8,15H,4,9-14H2,1H3/b23-22- |
| InChIKey | RDCCWGZBVCBHMF-FCQUAONHSA-N |
| XLogP | 4.01 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|