C25H21N3O2S — CID 16605495
10-[2-[2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-2-oxoethyl]acridin-9-one (PubChem CID 16605495) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is 10-[2-[2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-2-oxoethyl]acridin-9-one.
| Compound Name | 10-[2-[2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-2-oxoethyl]acridin-9-one |
|---|---|
| PubChem CID | 16605495 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 10-[2-[2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-2-oxoethyl]acridin-9-one |
| SMILES | Cc1ccccc1/N=C1\SCCN1C(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C25H21N3O2S/c1-17-8-2-5-11-20(17)26-25-27(14-15-31-25)23(29)16-28-21-12-6-3-9-18(21)24(30)19-10-4-7-13-22(19)28/h2-13H,14-16H2,1H3/b26-25- |
| InChIKey | CQLFHBIKXBKIBJ-QPLCGJKRSA-N |
| XLogP | 4.73 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|