C21H21N3O3S — CID 18270932
3-[4-[2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-4-oxobutyl]-1,3-benzoxazol-2-one (PubChem CID 18270932) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[4-[2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-4-oxobutyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[4-[2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-4-oxobutyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 18270932 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-[4-[2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-4-oxobutyl]-1,3-benzoxazol-2-one |
| SMILES | Cc1ccccc1/N=C1\SCCN1C(=O)CCCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C21H21N3O3S/c1-15-7-2-3-8-16(15)22-20-24(13-14-28-20)19(25)11-6-12-23-17-9-4-5-10-18(17)27-21(23)26/h2-5,7-10H,6,11-14H2,1H3/b22-20- |
| InChIKey | NAAOSHQSVYFGCE-XDOYNYLZSA-N |
| XLogP | 3.95 |
| TPSA | 67.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|