C25H20N2O4S — CID 16587482
[2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 16587482) has the molecular formula C25H20N2O4S and a molecular weight of 444.51 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 16587482 |
| Molecular Formula | C25H20N2O4S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)OCC(=O)N1CCSc2ccccc21 |
| InChI | InChI=1S/C25H20N2O4S/c28-23(26-13-14-32-22-12-6-5-11-21(22)26)16-31-24(29)15-27-19-9-3-1-7-17(19)25(30)18-8-2-4-10-20(18)27/h1-12H,13-16H2 |
| InChIKey | VLHJOWDMFZADLZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|