C25H17NO5S — CID 42980437
[2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 42980437) has the molecular formula C25H17NO5S and a molecular weight of 443.48 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 42980437 |
| Molecular Formula | C25H17NO5S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | O=C(OCC(=O)N1CCSc2ccccc21)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H17NO5S/c27-21(26-12-13-32-20-11-4-3-10-19(20)26)14-31-25(30)18-9-5-8-17-22(18)24(29)16-7-2-1-6-15(16)23(17)28/h1-11H,12-14H2 |
| InChIKey | HUQXYNKKIXUIQK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|