C26H21F3N2O3S — CID 5137010
2-(4-benzoylphenoxy)-1-[2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinan-3-yl]ethanone (PubChem CID 5137010) has the molecular formula C26H21F3N2O3S and a molecular weight of 498.53 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-1-[2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinan-3-yl]ethanone.
| Compound Name | 2-(4-benzoylphenoxy)-1-[2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinan-3-yl]ethanone |
|---|---|
| PubChem CID | 5137010 |
| Molecular Formula | C26H21F3N2O3S |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 2-(4-benzoylphenoxy)-1-[2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinan-3-yl]ethanone |
| SMILES | O=C(c1ccccc1)c1ccc(OCC(=O)N2CCCS/C2=N\c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C26H21F3N2O3S/c27-26(28,29)20-8-4-9-21(16-20)30-25-31(14-5-15-35-25)23(32)17-34-22-12-10-19(11-13-22)24(33)18-6-2-1-3-7-18/h1-4,6-13,16H,5,14-15,17H2/b30-25- |
| InChIKey | FKROZFZVVVETGK-JVCXMKTPSA-N |
| XLogP | 5.97 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|