C16H13Cl2N3OS — CID 8749122
(5,6-dichloro-3-pyridinyl)-(2-phenylimino-1,3-thiazinan-3-yl)methanone (PubChem CID 8749122) has the molecular formula C16H13Cl2N3OS and a molecular weight of 366.27 g/mol. Its IUPAC name is (5,6-dichloro-3-pyridinyl)-(2-phenylimino-1,3-thiazinan-3-yl)methanone.
| Compound Name | (5,6-dichloro-3-pyridinyl)-(2-phenylimino-1,3-thiazinan-3-yl)methanone |
|---|---|
| PubChem CID | 8749122 |
| Molecular Formula | C16H13Cl2N3OS |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | (5,6-dichloro-3-pyridinyl)-(2-phenylimino-1,3-thiazinan-3-yl)methanone |
| SMILES | O=C(c1cnc(Cl)c(Cl)c1)N1CCCS/C1=N\c1ccccc1 |
| InChI | InChI=1S/C16H13Cl2N3OS/c17-13-9-11(10-19-14(13)18)15(22)21-7-4-8-23-16(21)20-12-5-2-1-3-6-12/h1-3,5-6,9-10H,4,7-8H2/b20-16- |
| InChIKey | FLTIARZWBDMFBM-SILNSSARSA-N |
| XLogP | 4.66 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|