C21H18Cl2N4O2S — CID 55335519
4-[2-(3,4-dichlorophenyl)imino-1,3-thiazinane-3-carbonyl]-2-ethylphthalazin-1-one (PubChem CID 55335519) has the molecular formula C21H18Cl2N4O2S and a molecular weight of 461.37 g/mol. Its IUPAC name is 4-[2-(3,4-dichlorophenyl)imino-1,3-thiazinane-3-carbonyl]-2-ethylphthalazin-1-one.
| Compound Name | 4-[2-(3,4-dichlorophenyl)imino-1,3-thiazinane-3-carbonyl]-2-ethylphthalazin-1-one |
|---|---|
| PubChem CID | 55335519 |
| Molecular Formula | C21H18Cl2N4O2S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 4-[2-(3,4-dichlorophenyl)imino-1,3-thiazinane-3-carbonyl]-2-ethylphthalazin-1-one |
| SMILES | CCn1nc(C(=O)N2CCCS/C2=N\c2ccc(Cl)c(Cl)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H18Cl2N4O2S/c1-2-27-19(28)15-7-4-3-6-14(15)18(25-27)20(29)26-10-5-11-30-21(26)24-13-8-9-16(22)17(23)12-13/h3-4,6-9,12H,2,5,10-11H2,1H3/b24-21- |
| InChIKey | ZIAOIZYYOAFBQH-FLFQWRMESA-N |
| XLogP | 4.99 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|