C19H16ClN3OS — CID 7943512
3-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinane-3-carbonyl]benzonitrile (PubChem CID 7943512) has the molecular formula C19H16ClN3OS and a molecular weight of 369.88 g/mol. Its IUPAC name is 3-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinane-3-carbonyl]benzonitrile.
| Compound Name | 3-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinane-3-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 7943512 |
| Molecular Formula | C19H16ClN3OS |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 3-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinane-3-carbonyl]benzonitrile |
| SMILES | Cc1ccc(/N=C2\SCCCN2C(=O)c2cccc(C#N)c2)cc1Cl |
| InChI | InChI=1S/C19H16ClN3OS/c1-13-6-7-16(11-17(13)20)22-19-23(8-3-9-25-19)18(24)15-5-2-4-14(10-15)12-21/h2,4-7,10-11H,3,8-9H2,1H3/b22-19- |
| InChIKey | KUVUCEPOZWQOCI-QOCHGBHMSA-N |
| XLogP | 4.79 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|