C20H19N3OS2 — CID 16549450
1,3-benzothiazol-6-yl-[2-(2,6-dimethylphenyl)imino-1,3-thiazinan-3-yl]methanone (PubChem CID 16549450) has the molecular formula C20H19N3OS2 and a molecular weight of 381.53 g/mol. Its IUPAC name is 1,3-benzothiazol-6-yl-[2-(2,6-dimethylphenyl)imino-1,3-thiazinan-3-yl]methanone.
| Compound Name | 1,3-benzothiazol-6-yl-[2-(2,6-dimethylphenyl)imino-1,3-thiazinan-3-yl]methanone |
|---|---|
| PubChem CID | 16549450 |
| Molecular Formula | C20H19N3OS2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1,3-benzothiazol-6-yl-[2-(2,6-dimethylphenyl)imino-1,3-thiazinan-3-yl]methanone |
| SMILES | Cc1cccc(C)c1/N=C1\SCCCN1C(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C20H19N3OS2/c1-13-5-3-6-14(2)18(13)22-20-23(9-4-10-25-20)19(24)15-7-8-16-17(11-15)26-12-21-16/h3,5-8,11-12H,4,9-10H2,1-2H3/b22-20- |
| InChIKey | MORXMRFJSLZKDP-XDOYNYLZSA-N |
| XLogP | 5.18 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|