C21H22N2O2S — CID 7943621
1-[4-[[3-(3,5-dimethylbenzoyl)-1,3-thiazinan-2-ylidene]amino]phenyl]ethanone (PubChem CID 7943621) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-[4-[[3-(3,5-dimethylbenzoyl)-1,3-thiazinan-2-ylidene]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[3-(3,5-dimethylbenzoyl)-1,3-thiazinan-2-ylidene]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 7943621 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1-[4-[[3-(3,5-dimethylbenzoyl)-1,3-thiazinan-2-ylidene]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(/N=C2\SCCCN2C(=O)c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-14-11-15(2)13-18(12-14)20(25)23-9-4-10-26-21(23)22-19-7-5-17(6-8-19)16(3)24/h5-8,11-13H,4,9-10H2,1-3H3/b22-21- |
| InChIKey | OSNDZZDJBULDMU-DQRAZIAOSA-N |
| XLogP | 4.77 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|