C24H22N2O3S — CID 8895629
1-[2-(4-acetylphenyl)imino-1,3-thiazinan-3-yl]-2-naphthalen-1-yloxyethanone (PubChem CID 8895629) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is 1-[2-(4-acetylphenyl)imino-1,3-thiazinan-3-yl]-2-naphthalen-1-yloxyethanone.
| Compound Name | 1-[2-(4-acetylphenyl)imino-1,3-thiazinan-3-yl]-2-naphthalen-1-yloxyethanone |
|---|---|
| PubChem CID | 8895629 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 1-[2-(4-acetylphenyl)imino-1,3-thiazinan-3-yl]-2-naphthalen-1-yloxyethanone |
| SMILES | CC(=O)c1ccc(/N=C2\SCCCN2C(=O)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H22N2O3S/c1-17(27)18-10-12-20(13-11-18)25-24-26(14-5-15-30-24)23(28)16-29-22-9-4-7-19-6-2-3-8-21(19)22/h2-4,6-13H,5,14-16H2,1H3/b25-24- |
| InChIKey | NZTDTCJGEYJBPU-IZHYLOQSSA-N |
| XLogP | 5.07 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|