C19H16BrF3N2O2S — CID 4018399
2-(4-bromophenoxy)-1-[2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinan-3-yl]ethanone (PubChem CID 4018399) has the molecular formula C19H16BrF3N2O2S and a molecular weight of 473.31 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-1-[2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinan-3-yl]ethanone.
| Compound Name | 2-(4-bromophenoxy)-1-[2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinan-3-yl]ethanone |
|---|---|
| PubChem CID | 4018399 |
| Molecular Formula | C19H16BrF3N2O2S |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | 2-(4-bromophenoxy)-1-[2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinan-3-yl]ethanone |
| SMILES | O=C(COc1ccc(Br)cc1)N1CCCS/C1=N\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16BrF3N2O2S/c20-14-5-7-16(8-6-14)27-12-17(26)25-9-2-10-28-18(25)24-15-4-1-3-13(11-15)19(21,22)23/h1,3-8,11H,2,9-10,12H2/b24-18- |
| InChIKey | OIQQXCYNJDFFNV-MOHJPFBDSA-N |
| XLogP | 5.50 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|